C17H19Cl2IN6 — CID 111014940
1-[2-(2,4-dichlorophenyl)ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111014940) has the molecular formula C17H19Cl2IN6 and a molecular weight of 505.19 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,4-dichlorophenyl)ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111014940 |
| Molecular Formula | C17H19Cl2IN6 |
| Molecular Weight | 505.19 g/mol |
| Exact Mass | 504.01 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(Cl)cc1Cl)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C17H18Cl2N6.HI/c1-20-17(21-8-7-12-5-6-13(18)10-14(12)19)22-11-16-24-23-15-4-2-3-9-25(15)16;/h2-6,9-10H,7-8,11H2,1H3,(H2,20,21,22);1H |
| InChIKey | ISJIIYFWMGOOBS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.19 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|