C17H18Cl2N6 — CID 111014915
2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111014915) has the molecular formula C17H18Cl2N6 and a molecular weight of 377.28 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111014915 |
| Molecular Formula | C17H18Cl2N6 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1Cl)NCc1nnc2ccccn12 |
| InChI | InChI=1S/C17H18Cl2N6/c1-2-20-17(21-10-12-6-7-13(18)9-14(12)19)22-11-16-24-23-15-5-3-4-8-25(15)16/h3-9H,2,10-11H2,1H3,(H2,20,21,22) |
| InChIKey | ZACJLVJBUJJZJB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|