C20H27IN6O3 — CID 111013392
1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111013392) has the molecular formula C20H27IN6O3 and a molecular weight of 526.38 g/mol. Its IUPAC name is 1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111013392 |
| Molecular Formula | C20H27IN6O3 |
| Molecular Weight | 526.38 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | 1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC)c1OC)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C20H26N6O3.HI/c1-5-21-20(23-13-17-25-24-16-8-6-7-11-26(16)17)22-12-14-9-10-15(27-2)19(29-4)18(14)28-3;/h6-11H,5,12-13H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | IUCRPQLIDMZNPJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|