C17H21IN6 — CID 110954265
2-benzyl-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 110954265) has the molecular formula C17H21IN6 and a molecular weight of 436.30 g/mol. Its IUPAC name is 2-benzyl-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-benzyl-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110954265 |
| Molecular Formula | C17H21IN6 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 2-benzyl-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C17H20N6.HI/c1-2-18-17(19-12-14-8-4-3-5-9-14)20-13-16-22-21-15-10-6-7-11-23(15)16;/h3-11H,2,12-13H2,1H3,(H2,18,19,20);1H |
| InChIKey | ZKVUCXUNNGIYEH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|