C23H32IN7 — CID 111789007
1-ethyl-2-[[4-(4-methylpiperidin-1-yl)phenyl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111789007) has the molecular formula C23H32IN7 and a molecular weight of 533.46 g/mol. Its IUPAC name is 1-ethyl-2-[[4-(4-methylpiperidin-1-yl)phenyl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[4-(4-methylpiperidin-1-yl)phenyl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111789007 |
| Molecular Formula | C23H32IN7 |
| Molecular Weight | 533.46 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 1-ethyl-2-[[4-(4-methylpiperidin-1-yl)phenyl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCC(C)CC2)cc1)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C23H31N7.HI/c1-3-24-23(26-17-22-28-27-21-6-4-5-13-30(21)22)25-16-19-7-9-20(10-8-19)29-14-11-18(2)12-15-29;/h4-10,13,18H,3,11-12,14-17H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | RRKIKDFJDTYUJI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|