C18H20F3IN6 — CID 111013610
1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111013610) has the molecular formula C18H20F3IN6 and a molecular weight of 504.30 g/mol. Its IUPAC name is 1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111013610 |
| Molecular Formula | C18H20F3IN6 |
| Molecular Weight | 504.30 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | 1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(F)(F)F)cc1)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C18H19F3N6.HI/c1-2-22-17(23-11-13-6-8-14(9-7-13)18(19,20)21)24-12-16-26-25-15-5-3-4-10-27(15)16;/h3-10H,2,11-12H2,1H3,(H2,22,23,24);1H |
| InChIKey | OJKIUDIPVQZVPK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.30 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|