C21H27N7O — CID 111015929
N-[4-[[[ethylamino-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)methylidene]amino]methyl]phenyl]-2-methylpropanamide (PubChem CID 111015929) has the molecular formula C21H27N7O and a molecular weight of 393.50 g/mol. Its IUPAC name is N-[4-[[[ethylamino-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)methylidene]amino]methyl]phenyl]-2-methylpropanamide.
| Compound Name | N-[4-[[[ethylamino-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)methylidene]amino]methyl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 111015929 |
| Molecular Formula | C21H27N7O |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | N-[4-[[[ethylamino-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)methylidene]amino]methyl]phenyl]-2-methylpropanamide |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)C(C)C)cc1)NCc1nnc2ccccn12 |
| InChI | InChI=1S/C21H27N7O/c1-4-22-21(24-14-19-27-26-18-7-5-6-12-28(18)19)23-13-16-8-10-17(11-9-16)25-20(29)15(2)3/h5-12,15H,4,13-14H2,1-3H3,(H,25,29)(H2,22,23,24) |
| InChIKey | URKLZDMCCKSFJQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|