C22H29N7O — CID 111013411
N-[3-[[[ethylamino-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)methylidene]amino]methyl]phenyl]-2-methylbutanamide (PubChem CID 111013411) has the molecular formula C22H29N7O and a molecular weight of 407.52 g/mol. Its IUPAC name is N-[3-[[[ethylamino-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)methylidene]amino]methyl]phenyl]-2-methylbutanamide.
| Compound Name | N-[3-[[[ethylamino-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)methylidene]amino]methyl]phenyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 111013411 |
| Molecular Formula | C22H29N7O |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | N-[3-[[[ethylamino-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)methylidene]amino]methyl]phenyl]-2-methylbutanamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C(C)CC)c1)NCc1nnc2ccccn12 |
| InChI | InChI=1S/C22H29N7O/c1-4-16(3)21(30)26-18-10-8-9-17(13-18)14-24-22(23-5-2)25-15-20-28-27-19-11-6-7-12-29(19)20/h6-13,16H,4-5,14-15H2,1-3H3,(H,26,30)(H2,23,24,25) |
| InChIKey | GKPVOGSKGPTIMW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|