C22H34N6O — CID 111952189
N-[3-[[[ethylamino-[(1,3,5-trimethylpyrazol-4-yl)methylamino]methylidene]amino]methyl]phenyl]-2-methylbutanamide (PubChem CID 111952189) has the molecular formula C22H34N6O and a molecular weight of 398.56 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[(1,3,5-trimethylpyrazol-4-yl)methylamino]methylidene]amino]methyl]phenyl]-2-methylbutanamide.
| Compound Name | N-[3-[[[ethylamino-[(1,3,5-trimethylpyrazol-4-yl)methylamino]methylidene]amino]methyl]phenyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 111952189 |
| Molecular Formula | C22H34N6O |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | N-[3-[[[ethylamino-[(1,3,5-trimethylpyrazol-4-yl)methylamino]methylidene]amino]methyl]phenyl]-2-methylbutanamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C(C)CC)c1)NCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C22H34N6O/c1-7-15(3)21(29)26-19-11-9-10-18(12-19)13-24-22(23-8-2)25-14-20-16(4)27-28(6)17(20)5/h9-12,15H,7-8,13-14H2,1-6H3,(H,26,29)(H2,23,24,25) |
| InChIKey | MSOWUZBIVOXWMR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|