C25H32IN5O2 — CID 111552553
N-[3-[[[ethylamino-[(2-phenyl-1,3-oxazol-4-yl)methylamino]methylidene]amino]methyl]phenyl]-2-methylbutanamide;hydroiodide (PubChem CID 111552553) has the molecular formula C25H32IN5O2 and a molecular weight of 561.47 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[(2-phenyl-1,3-oxazol-4-yl)methylamino]methylidene]amino]methyl]phenyl]-2-methylbutanamide;hydroiodide.
| Compound Name | N-[3-[[[ethylamino-[(2-phenyl-1,3-oxazol-4-yl)methylamino]methylidene]amino]methyl]phenyl]-2-methylbutanamide;hydroiodide |
|---|---|
| PubChem CID | 111552553 |
| Molecular Formula | C25H32IN5O2 |
| Molecular Weight | 561.47 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | N-[3-[[[ethylamino-[(2-phenyl-1,3-oxazol-4-yl)methylamino]methylidene]amino]methyl]phenyl]-2-methylbutanamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C(C)CC)c1)NCc1coc(-c2ccccc2)n1.I |
| InChI | InChI=1S/C25H31N5O2.HI/c1-4-18(3)23(31)29-21-13-9-10-19(14-21)15-27-25(26-5-2)28-16-22-17-32-24(30-22)20-11-7-6-8-12-20;/h6-14,17-18H,4-5,15-16H2,1-3H3,(H,29,31)(H2,26,27,28);1H |
| InChIKey | QDIAGWDPOGJUBD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|