C23H27N5O2 — CID 111553255
N-(3-ethylphenyl)-2-[[N-ethyl-N'-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]acetamide (PubChem CID 111553255) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-(3-ethylphenyl)-2-[[N-ethyl-N'-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N-(3-ethylphenyl)-2-[[N-ethyl-N'-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111553255 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | N-(3-ethylphenyl)-2-[[N-ethyl-N'-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]acetamide |
| SMILES | CCN/C(=N\Cc1coc(-c2ccccc2)n1)NCC(=O)Nc1cccc(CC)c1 |
| InChI | InChI=1S/C23H27N5O2/c1-3-17-9-8-12-19(13-17)27-21(29)15-26-23(24-4-2)25-14-20-16-30-22(28-20)18-10-6-5-7-11-18/h5-13,16H,3-4,14-15H2,1-2H3,(H,27,29)(H2,24,25,26) |
| InChIKey | RWSQCZLDQBDAKT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|