C22H25FIN5O2 — CID 111590706
2-[[N-ethyl-N'-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]carbamimidoyl]amino]-N-(3-fluorophenyl)acetamide;hydroiodide (PubChem CID 111590706) has the molecular formula C22H25FIN5O2 and a molecular weight of 537.38 g/mol. Its IUPAC name is 2-[[N-ethyl-N'-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]carbamimidoyl]amino]-N-(3-fluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[N-ethyl-N'-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]carbamimidoyl]amino]-N-(3-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111590706 |
| Molecular Formula | C22H25FIN5O2 |
| Molecular Weight | 537.38 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | 2-[[N-ethyl-N'-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]carbamimidoyl]amino]-N-(3-fluorophenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1coc(-c2ccc(C)cc2)n1)NCC(=O)Nc1cccc(F)c1.I |
| InChI | InChI=1S/C22H24FN5O2.HI/c1-3-24-22(26-13-20(29)27-18-6-4-5-17(23)11-18)25-12-19-14-30-21(28-19)16-9-7-15(2)8-10-16;/h4-11,14H,3,12-13H2,1-2H3,(H,27,29)(H2,24,25,26);1H |
| InChIKey | YUONMXKSIQDLTJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|