C15H23FIN5O2 — CID 111364702
2-[[N-ethyl-N'-[2-(3-fluoroanilino)-2-oxoethyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111364702) has the molecular formula C15H23FIN5O2 and a molecular weight of 451.28 g/mol. Its IUPAC name is 2-[[N-ethyl-N'-[2-(3-fluoroanilino)-2-oxoethyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N-ethyl-N'-[2-(3-fluoroanilino)-2-oxoethyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111364702 |
| Molecular Formula | C15H23FIN5O2 |
| Molecular Weight | 451.28 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 2-[[N-ethyl-N'-[2-(3-fluoroanilino)-2-oxoethyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1cccc(F)c1)NCC(=O)N(C)C.I |
| InChI | InChI=1S/C15H22FN5O2.HI/c1-4-17-15(19-10-14(23)21(2)3)18-9-13(22)20-12-7-5-6-11(16)8-12;/h5-8H,4,9-10H2,1-3H3,(H,20,22)(H2,17,18,19);1H |
| InChIKey | LDLCEUYRQNQGBT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|