C20H29FIN5O2 — CID 111675649
2-[[ethylamino-[(3-pentan-3-yl-1,2-oxazol-5-yl)methylamino]methylidene]amino]-N-(3-fluorophenyl)acetamide;hydroiodide (PubChem CID 111675649) has the molecular formula C20H29FIN5O2 and a molecular weight of 517.39 g/mol. Its IUPAC name is 2-[[ethylamino-[(3-pentan-3-yl-1,2-oxazol-5-yl)methylamino]methylidene]amino]-N-(3-fluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[(3-pentan-3-yl-1,2-oxazol-5-yl)methylamino]methylidene]amino]-N-(3-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111675649 |
| Molecular Formula | C20H29FIN5O2 |
| Molecular Weight | 517.39 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | 2-[[ethylamino-[(3-pentan-3-yl-1,2-oxazol-5-yl)methylamino]methylidene]amino]-N-(3-fluorophenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1cccc(F)c1)NCc1cc(C(CC)CC)no1.I |
| InChI | InChI=1S/C20H28FN5O2.HI/c1-4-14(5-2)18-11-17(28-26-18)12-23-20(22-6-3)24-13-19(27)25-16-9-7-8-15(21)10-16;/h7-11,14H,4-6,12-13H2,1-3H3,(H,25,27)(H2,22,23,24);1H |
| InChIKey | NKIHAMWQDMCHNP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|