C22H33N5O2 — CID 111676114
2-[[ethylamino-[(3-pentan-3-yl-1,2-oxazol-5-yl)methylamino]methylidene]amino]-N-(2-phenylethyl)acetamide (PubChem CID 111676114) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 2-[[ethylamino-[(3-pentan-3-yl-1,2-oxazol-5-yl)methylamino]methylidene]amino]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[[ethylamino-[(3-pentan-3-yl-1,2-oxazol-5-yl)methylamino]methylidene]amino]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 111676114 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | 2-[[ethylamino-[(3-pentan-3-yl-1,2-oxazol-5-yl)methylamino]methylidene]amino]-N-(2-phenylethyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)NCCc1ccccc1)NCc1cc(C(CC)CC)no1 |
| InChI | InChI=1S/C22H33N5O2/c1-4-18(5-2)20-14-19(29-27-20)15-25-22(23-6-3)26-16-21(28)24-13-12-17-10-8-7-9-11-17/h7-11,14,18H,4-6,12-13,15-16H2,1-3H3,(H,24,28)(H2,23,25,26) |
| InChIKey | STCMYSZUGHEGJJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|