C20H30IN5O2 — CID 111675587
2-[[ethylamino-[(3-pentan-3-yl-1,2-oxazol-5-yl)methylamino]methylidene]amino]-N-phenylacetamide;hydroiodide (PubChem CID 111675587) has the molecular formula C20H30IN5O2 and a molecular weight of 499.40 g/mol. Its IUPAC name is 2-[[ethylamino-[(3-pentan-3-yl-1,2-oxazol-5-yl)methylamino]methylidene]amino]-N-phenylacetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[(3-pentan-3-yl-1,2-oxazol-5-yl)methylamino]methylidene]amino]-N-phenylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111675587 |
| Molecular Formula | C20H30IN5O2 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 2-[[ethylamino-[(3-pentan-3-yl-1,2-oxazol-5-yl)methylamino]methylidene]amino]-N-phenylacetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccccc1)NCc1cc(C(CC)CC)no1.I |
| InChI | InChI=1S/C20H29N5O2.HI/c1-4-15(5-2)18-12-17(27-25-18)13-22-20(21-6-3)23-14-19(26)24-16-10-8-7-9-11-16;/h7-12,15H,4-6,13-14H2,1-3H3,(H,24,26)(H2,21,22,23);1H |
| InChIKey | XXCJJKRVEVHYPM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|