C22H33N5O2 — CID 111676154
N-ethyl-4-[[[ethylamino-[(3-pentan-3-yl-1,2-oxazol-5-yl)methylamino]methylidene]amino]methyl]benzamide (PubChem CID 111676154) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is N-ethyl-4-[[[ethylamino-[(3-pentan-3-yl-1,2-oxazol-5-yl)methylamino]methylidene]amino]methyl]benzamide.
| Compound Name | N-ethyl-4-[[[ethylamino-[(3-pentan-3-yl-1,2-oxazol-5-yl)methylamino]methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111676154 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | N-ethyl-4-[[[ethylamino-[(3-pentan-3-yl-1,2-oxazol-5-yl)methylamino]methylidene]amino]methyl]benzamide |
| SMILES | CCNC(=O)c1ccc(C/N=C(\NCC)NCc2cc(C(CC)CC)no2)cc1 |
| InChI | InChI=1S/C22H33N5O2/c1-5-17(6-2)20-13-19(29-27-20)15-26-22(24-8-4)25-14-16-9-11-18(12-10-16)21(28)23-7-3/h9-13,17H,5-8,14-15H2,1-4H3,(H,23,28)(H2,24,25,26) |
| InChIKey | JUYWCLUOMDROJW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|