C23H36N4O4 — CID 111676364
2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine (PubChem CID 111676364) has the molecular formula C23H36N4O4 and a molecular weight of 432.57 g/mol. Its IUPAC name is 2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine.
| Compound Name | 2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111676364 |
| Molecular Formula | C23H36N4O4 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | 2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OCC)c(OC)c1)NCc1cc(C(CC)CC)no1 |
| InChI | InChI=1S/C23H36N4O4/c1-7-17(8-2)19-13-18(31-27-19)15-26-23(24-9-3)25-14-16-11-20(28-5)22(30-10-4)21(12-16)29-6/h11-13,17H,7-10,14-15H2,1-6H3,(H2,24,25,26) |
| InChIKey | KDSRXMMJQSVYPZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|