C20H32IN5O2 — CID 111676143
2-[(2-ethoxy-3-pyridinyl)methyl]-1-ethyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111676143) has the molecular formula C20H32IN5O2 and a molecular weight of 501.41 g/mol. Its IUPAC name is 2-[(2-ethoxy-3-pyridinyl)methyl]-1-ethyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[(2-ethoxy-3-pyridinyl)methyl]-1-ethyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111676143 |
| Molecular Formula | C20H32IN5O2 |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | 2-[(2-ethoxy-3-pyridinyl)methyl]-1-ethyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1OCC)NCc1cc(C(CC)CC)no1.I |
| InChI | InChI=1S/C20H31N5O2.HI/c1-5-15(6-2)18-12-17(27-25-18)14-24-20(21-7-3)23-13-16-10-9-11-22-19(16)26-8-4;/h9-12,15H,5-8,13-14H2,1-4H3,(H2,21,23,24);1H |
| InChIKey | LPCFAMRZDVUYDG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|