C16H24IN5OS — CID 111522233
2-[(2-ethoxy-3-pyridinyl)methyl]-1-ethyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111522233) has the molecular formula C16H24IN5OS and a molecular weight of 461.37 g/mol. Its IUPAC name is 2-[(2-ethoxy-3-pyridinyl)methyl]-1-ethyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[(2-ethoxy-3-pyridinyl)methyl]-1-ethyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111522233 |
| Molecular Formula | C16H24IN5OS |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 2-[(2-ethoxy-3-pyridinyl)methyl]-1-ethyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1OCC)NCc1ncc(C)s1.I |
| InChI | InChI=1S/C16H23N5OS.HI/c1-4-17-16(21-11-14-19-9-12(3)23-14)20-10-13-7-6-8-18-15(13)22-5-2;/h6-9H,4-5,10-11H2,1-3H3,(H2,17,20,21);1H |
| InChIKey | YONGYGKZXHZNQV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|