C13H18BrIN4S2 — CID 111522337
2-[(5-bromothiophen-2-yl)methyl]-1-ethyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111522337) has the molecular formula C13H18BrIN4S2 and a molecular weight of 501.26 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)methyl]-1-ethyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[(5-bromothiophen-2-yl)methyl]-1-ethyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111522337 |
| Molecular Formula | C13H18BrIN4S2 |
| Molecular Weight | 501.26 g/mol |
| Exact Mass | 499.92 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)methyl]-1-ethyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Br)s1)NCc1ncc(C)s1.I |
| InChI | InChI=1S/C13H17BrN4S2.HI/c1-3-15-13(17-7-10-4-5-11(14)20-10)18-8-12-16-6-9(2)19-12;/h4-6H,3,7-8H2,1-2H3,(H2,15,17,18);1H |
| InChIKey | ZRWPZUTWKNOIPX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.26 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|