C13H14BrF3N4S2 — CID 111617275
2-[(5-bromothiophen-2-yl)methyl]-1-ethyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111617275) has the molecular formula C13H14BrF3N4S2 and a molecular weight of 427.32 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)methyl]-1-ethyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 2-[(5-bromothiophen-2-yl)methyl]-1-ethyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111617275 |
| Molecular Formula | C13H14BrF3N4S2 |
| Molecular Weight | 427.32 g/mol |
| Exact Mass | 425.98 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)methyl]-1-ethyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Br)s1)NCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C13H14BrF3N4S2/c1-2-18-12(19-5-8-3-4-10(14)23-8)20-6-11-21-9(7-22-11)13(15,16)17/h3-4,7H,2,5-6H2,1H3,(H2,18,19,20) |
| InChIKey | MWZPFANDUAWNEN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.32 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|