C14H18F3N5O2S3 — CID 111688434
1-ethyl-2-[(5-sulfamoylthiophen-2-yl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine (PubChem CID 111688434) has the molecular formula C14H18F3N5O2S3 and a molecular weight of 441.53 g/mol. Its IUPAC name is 1-ethyl-2-[(5-sulfamoylthiophen-2-yl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine.
| Compound Name | 1-ethyl-2-[(5-sulfamoylthiophen-2-yl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111688434 |
| Molecular Formula | C14H18F3N5O2S3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 1-ethyl-2-[(5-sulfamoylthiophen-2-yl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)s1)NCCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C14H18F3N5O2S3/c1-2-19-13(21-7-9-3-4-12(26-9)27(18,23)24)20-6-5-11-22-10(8-25-11)14(15,16)17/h3-4,8H,2,5-7H2,1H3,(H2,18,23,24)(H2,19,20,21) |
| InChIKey | OWTQOAHVYCBYJE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|