C14H18F3IN4S2 — CID 111688153
1-ethyl-2-(thiophen-2-ylmethyl)-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111688153) has the molecular formula C14H18F3IN4S2 and a molecular weight of 490.36 g/mol. Its IUPAC name is 1-ethyl-2-(thiophen-2-ylmethyl)-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(thiophen-2-ylmethyl)-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111688153 |
| Molecular Formula | C14H18F3IN4S2 |
| Molecular Weight | 490.36 g/mol |
| Exact Mass | 490.00 |
| IUPAC Name | 1-ethyl-2-(thiophen-2-ylmethyl)-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccs1)NCCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C14H17F3N4S2.HI/c1-2-18-13(20-8-10-4-3-7-22-10)19-6-5-12-21-11(9-23-12)14(15,16)17;/h3-4,7,9H,2,5-6,8H2,1H3,(H2,18,19,20);1H |
| InChIKey | AUPDWRKQKHXQTA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|