C17H19F3IN5S — CID 111689173
2-[(4-cyanophenyl)methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111689173) has the molecular formula C17H19F3IN5S and a molecular weight of 509.34 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(4-cyanophenyl)methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111689173 |
| Molecular Formula | C17H19F3IN5S |
| Molecular Weight | 509.34 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | 2-[(4-cyanophenyl)methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C#N)cc1)NCCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C17H18F3N5S.HI/c1-2-22-16(24-10-13-5-3-12(9-21)4-6-13)23-8-7-15-25-14(11-26-15)17(18,19)20;/h3-6,11H,2,7-8,10H2,1H3,(H2,22,23,24);1H |
| InChIKey | UXSZOBRXEIQMES-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|