C16H17ClF4N4S — CID 111689370
2-[(3-chloro-4-fluorophenyl)methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine (PubChem CID 111689370) has the molecular formula C16H17ClF4N4S and a molecular weight of 408.85 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111689370 |
| Molecular Formula | C16H17ClF4N4S |
| Molecular Weight | 408.85 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(F)c(Cl)c1)NCCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C16H17ClF4N4S/c1-2-22-15(24-8-10-3-4-12(18)11(17)7-10)23-6-5-14-25-13(9-26-14)16(19,20)21/h3-4,7,9H,2,5-6,8H2,1H3,(H2,22,23,24) |
| InChIKey | FVDVANFQXGBJOC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.85 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|