C17H20F4N4S — CID 111689398
1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine (PubChem CID 111689398) has the molecular formula C17H20F4N4S and a molecular weight of 388.43 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111689398 |
| Molecular Formula | C17H20F4N4S |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1nc(C(F)(F)F)cs1)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C17H20F4N4S/c1-2-22-16(23-8-6-12-4-3-5-13(18)10-12)24-9-7-15-25-14(11-26-15)17(19,20)21/h3-5,10-11H,2,6-9H2,1H3,(H2,22,23,24) |
| InChIKey | OOGQOEYOFHVCAK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|