C13H19F3N4O2S — CID 111689146
methyl 3-[[N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]propanoate (PubChem CID 111689146) has the molecular formula C13H19F3N4O2S and a molecular weight of 352.38 g/mol. Its IUPAC name is methyl 3-[[N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]propanoate.
| Compound Name | methyl 3-[[N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]propanoate |
|---|---|
| PubChem CID | 111689146 |
| Molecular Formula | C13H19F3N4O2S |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | methyl 3-[[N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]propanoate |
| SMILES | CCN/C(=N\CCc1nc(C(F)(F)F)cs1)NCCC(=O)OC |
| InChI | InChI=1S/C13H19F3N4O2S/c1-3-17-12(19-7-5-11(21)22-2)18-6-4-10-20-9(8-23-10)13(14,15)16/h8H,3-7H2,1-2H3,(H2,17,18,19) |
| InChIKey | QWDBVUSUWPJIQN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|