C18H29F3IN5OS — CID 111688145
2-cyclopentyl-N-[2-[[N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide (PubChem CID 111688145) has the molecular formula C18H29F3IN5OS and a molecular weight of 547.43 g/mol. Its IUPAC name is 2-cyclopentyl-N-[2-[[N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide.
| Compound Name | 2-cyclopentyl-N-[2-[[N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111688145 |
| Molecular Formula | C18H29F3IN5OS |
| Molecular Weight | 547.43 g/mol |
| Exact Mass | 547.11 |
| IUPAC Name | 2-cyclopentyl-N-[2-[[N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1nc(C(F)(F)F)cs1)NCCNC(=O)CC1CCCC1.I |
| InChI | InChI=1S/C18H28F3N5OS.HI/c1-2-22-17(24-8-7-16-26-14(12-28-16)18(19,20)21)25-10-9-23-15(27)11-13-5-3-4-6-13;/h12-13H,2-11H2,1H3,(H,23,27)(H2,22,24,25);1H |
| InChIKey | UPWXRVUUKRWUOT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|