C12H18F3IN4S — CID 111687799
1-cyclopropyl-3-ethyl-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111687799) has the molecular formula C12H18F3IN4S and a molecular weight of 434.27 g/mol. Its IUPAC name is 1-cyclopropyl-3-ethyl-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-3-ethyl-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111687799 |
| Molecular Formula | C12H18F3IN4S |
| Molecular Weight | 434.27 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | 1-cyclopropyl-3-ethyl-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1nc(C(F)(F)F)cs1)NC1CC1.I |
| InChI | InChI=1S/C12H17F3N4S.HI/c1-2-16-11(18-8-3-4-8)17-6-5-10-19-9(7-20-10)12(13,14)15;/h7-8H,2-6H2,1H3,(H2,16,17,18);1H |
| InChIKey | IHZKRZRFGORKPX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|