C21H28F3N5S — CID 111689772
1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine (PubChem CID 111689772) has the molecular formula C21H28F3N5S and a molecular weight of 439.55 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111689772 |
| Molecular Formula | C21H28F3N5S |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1nc(C(F)(F)F)cs1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H28F3N5S/c1-2-25-20(26-11-8-19-28-18(15-30-19)21(22,23)24)27-17-9-12-29(13-10-17)14-16-6-4-3-5-7-16/h3-7,15,17H,2,8-14H2,1H3,(H2,25,26,27) |
| InChIKey | GYBYZZQKWRTOGH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|