C20H38IN5S — CID 111834452
2-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide (PubChem CID 111834452) has the molecular formula C20H38IN5S and a molecular weight of 507.53 g/mol. Its IUPAC name is 2-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide.
| Compound Name | 2-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111834452 |
| Molecular Formula | C20H38IN5S |
| Molecular Weight | 507.53 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 2-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
| SMILES | CCCN1CCC(N/C(=N/CCc2nc(C(C)(C)C)cs2)NCC)CC1.I |
| InChI | InChI=1S/C20H37N5S.HI/c1-6-12-25-13-9-16(10-14-25)23-19(21-7-2)22-11-8-18-24-17(15-26-18)20(3,4)5;/h15-16H,6-14H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | AVRUFGSFFKDASS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|