C17H30BrIN4S — CID 111017408
2-[2-(5-bromothiophen-2-yl)ethyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide (PubChem CID 111017408) has the molecular formula C17H30BrIN4S and a molecular weight of 529.33 g/mol. Its IUPAC name is 2-[2-(5-bromothiophen-2-yl)ethyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide.
| Compound Name | 2-[2-(5-bromothiophen-2-yl)ethyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111017408 |
| Molecular Formula | C17H30BrIN4S |
| Molecular Weight | 529.33 g/mol |
| Exact Mass | 528.04 |
| IUPAC Name | 2-[2-(5-bromothiophen-2-yl)ethyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
| SMILES | CCCN1CCC(N/C(=N/CCc2ccc(Br)s2)NCC)CC1.I |
| InChI | InChI=1S/C17H29BrN4S.HI/c1-3-11-22-12-8-14(9-13-22)21-17(19-4-2)20-10-7-15-5-6-16(18)23-15;/h5-6,14H,3-4,7-13H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | QROPYIJWQMWHQX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|