C18H32IN5OS — CID 111934504
2-cyclopentyl-N-[2-[[N-ethyl-N'-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide (PubChem CID 111934504) has the molecular formula C18H32IN5OS and a molecular weight of 493.46 g/mol. Its IUPAC name is 2-cyclopentyl-N-[2-[[N-ethyl-N'-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide.
| Compound Name | 2-cyclopentyl-N-[2-[[N-ethyl-N'-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111934504 |
| Molecular Formula | C18H32IN5OS |
| Molecular Weight | 493.46 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | 2-cyclopentyl-N-[2-[[N-ethyl-N'-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1csc(C)n1)NCCNC(=O)CC1CCCC1.I |
| InChI | InChI=1S/C18H31N5OS.HI/c1-3-19-18(21-9-8-16-13-25-14(2)23-16)22-11-10-20-17(24)12-15-6-4-5-7-15;/h13,15H,3-12H2,1-2H3,(H,20,24)(H2,19,21,22);1H |
| InChIKey | YESBKGQCOKGNTL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|