C18H24Cl2IN5OS — CID 111932191
3,4-dichloro-N-[2-[[N-ethyl-N'-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111932191) has the molecular formula C18H24Cl2IN5OS and a molecular weight of 556.30 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[[N-ethyl-N'-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | 3,4-dichloro-N-[2-[[N-ethyl-N'-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111932191 |
| Molecular Formula | C18H24Cl2IN5OS |
| Molecular Weight | 556.30 g/mol |
| Exact Mass | 555.01 |
| IUPAC Name | 3,4-dichloro-N-[2-[[N-ethyl-N'-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1csc(C)n1)NCCNC(=O)c1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C18H23Cl2N5OS.HI/c1-3-21-18(23-7-6-14-11-27-12(2)25-14)24-9-8-22-17(26)13-4-5-15(19)16(20)10-13;/h4-5,10-11H,3,6-9H2,1-2H3,(H,22,26)(H2,21,23,24);1H |
| InChIKey | YCTBOPTZTCZDKU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|