C18H29Cl2IN4O2 — CID 111943998
3,4-dichloro-N-[2-[[N'-(4-ethoxybutyl)-N-ethylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111943998) has the molecular formula C18H29Cl2IN4O2 and a molecular weight of 531.27 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[[N'-(4-ethoxybutyl)-N-ethylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | 3,4-dichloro-N-[2-[[N'-(4-ethoxybutyl)-N-ethylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111943998 |
| Molecular Formula | C18H29Cl2IN4O2 |
| Molecular Weight | 531.27 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | 3,4-dichloro-N-[2-[[N'-(4-ethoxybutyl)-N-ethylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\CCCCOCC)NCCNC(=O)c1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C18H28Cl2N4O2.HI/c1-3-21-18(23-9-5-6-12-26-4-2)24-11-10-22-17(25)14-7-8-15(19)16(20)13-14;/h7-8,13H,3-6,9-12H2,1-2H3,(H,22,25)(H2,21,23,24);1H |
| InChIKey | INUOOFXTPKKGKW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|