C19H30F3IN4O3 — CID 111404770
N-[2-[[N-ethyl-N'-[3-(2-methoxyethoxy)propyl]carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide (PubChem CID 111404770) has the molecular formula C19H30F3IN4O3 and a molecular weight of 546.37 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[3-(2-methoxyethoxy)propyl]carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[3-(2-methoxyethoxy)propyl]carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide |
|---|---|
| PubChem CID | 111404770 |
| Molecular Formula | C19H30F3IN4O3 |
| Molecular Weight | 546.37 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[3-(2-methoxyethoxy)propyl]carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide |
| SMILES | CCN/C(=N\CCCOCCOC)NCCNC(=O)c1ccc(C(F)(F)F)cc1.I |
| InChI | InChI=1S/C19H29F3N4O3.HI/c1-3-23-18(25-9-4-12-29-14-13-28-2)26-11-10-24-17(27)15-5-7-16(8-6-15)19(20,21)22;/h5-8H,3-4,9-14H2,1-2H3,(H,24,27)(H2,23,25,26);1H |
| InChIKey | YETOGTKRLRDRLN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|