C19H25F3N6O — CID 111904447
N-[2-[[N-ethyl-N'-(3-pyrazol-1-ylpropyl)carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 111904447) has the molecular formula C19H25F3N6O and a molecular weight of 410.44 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-(3-pyrazol-1-ylpropyl)carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[N-ethyl-N'-(3-pyrazol-1-ylpropyl)carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 111904447 |
| Molecular Formula | C19H25F3N6O |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-[2-[[N-ethyl-N'-(3-pyrazol-1-ylpropyl)carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | CCN/C(=N\CCCn1cccn1)NCCNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H25F3N6O/c1-2-23-18(25-9-3-13-28-14-4-10-27-28)26-12-11-24-17(29)15-5-7-16(8-6-15)19(20,21)22/h4-8,10,14H,2-3,9,11-13H2,1H3,(H,24,29)(H2,23,25,26) |
| InChIKey | IOBIQGQXHRTNKK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|