C19H27N5O2 — CID 111903911
methyl 4-[2-[[N-ethyl-N'-(3-pyrazol-1-ylpropyl)carbamimidoyl]amino]ethyl]benzoate (PubChem CID 111903911) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is methyl 4-[2-[[N-ethyl-N'-(3-pyrazol-1-ylpropyl)carbamimidoyl]amino]ethyl]benzoate.
| Compound Name | methyl 4-[2-[[N-ethyl-N'-(3-pyrazol-1-ylpropyl)carbamimidoyl]amino]ethyl]benzoate |
|---|---|
| PubChem CID | 111903911 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | methyl 4-[2-[[N-ethyl-N'-(3-pyrazol-1-ylpropyl)carbamimidoyl]amino]ethyl]benzoate |
| SMILES | CCN/C(=N\CCCn1cccn1)NCCc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C19H27N5O2/c1-3-20-19(21-11-4-14-24-15-5-12-23-24)22-13-10-16-6-8-17(9-7-16)18(25)26-2/h5-9,12,15H,3-4,10-11,13-14H2,1-2H3,(H2,20,21,22) |
| InChIKey | CROVBPXOEZKNEI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|