C21H34IN5O2 — CID 111863997
1-ethyl-2-[4-(2-methoxyethoxy)butyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111863997) has the molecular formula C21H34IN5O2 and a molecular weight of 515.44 g/mol. Its IUPAC name is 1-ethyl-2-[4-(2-methoxyethoxy)butyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[4-(2-methoxyethoxy)butyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111863997 |
| Molecular Formula | C21H34IN5O2 |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 1-ethyl-2-[4-(2-methoxyethoxy)butyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCOCCOC)NCCc1ccc(-n2cccn2)cc1.I |
| InChI | InChI=1S/C21H33N5O2.HI/c1-3-22-21(23-12-4-5-16-28-18-17-27-2)24-14-11-19-7-9-20(10-8-19)26-15-6-13-25-26;/h6-10,13,15H,3-5,11-12,14,16-18H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | CLGIZZLCZOZGRN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|