C24H37N7O — CID 111864174
1-[4-[[ethylamino-[2-(4-pyrazol-1-ylphenyl)ethylamino]methylidene]amino]butyl]piperidine-4-carboxamide (PubChem CID 111864174) has the molecular formula C24H37N7O and a molecular weight of 439.61 g/mol. Its IUPAC name is 1-[4-[[ethylamino-[2-(4-pyrazol-1-ylphenyl)ethylamino]methylidene]amino]butyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[[ethylamino-[2-(4-pyrazol-1-ylphenyl)ethylamino]methylidene]amino]butyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 111864174 |
| Molecular Formula | C24H37N7O |
| Molecular Weight | 439.61 g/mol |
| Exact Mass | 439.31 |
| IUPAC Name | 1-[4-[[ethylamino-[2-(4-pyrazol-1-ylphenyl)ethylamino]methylidene]amino]butyl]piperidine-4-carboxamide |
| SMILES | CCN/C(=N\CCCCN1CCC(C(N)=O)CC1)NCCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C24H37N7O/c1-2-26-24(27-13-3-4-16-30-18-11-21(12-19-30)23(25)32)28-15-10-20-6-8-22(9-7-20)31-17-5-14-29-31/h5-9,14,17,21H,2-4,10-13,15-16,18-19H2,1H3,(H2,25,32)(H2,26,27,28) |
| InChIKey | CMEBBRRQSFCCCG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.61 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|