C20H29IN8 — CID 111530926
1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]-2-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide (PubChem CID 111530926) has the molecular formula C20H29IN8 and a molecular weight of 508.41 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]-2-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]-2-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111530926 |
| Molecular Formula | C20H29IN8 |
| Molecular Weight | 508.41 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | 1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]-2-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCn1cnnc1)NCCc1ccc(-n2cccn2)cc1.I |
| InChI | InChI=1S/C20H28N8.HI/c1-2-21-20(22-11-3-4-14-27-16-24-25-17-27)23-13-10-18-6-8-19(9-7-18)28-15-5-12-26-28;/h5-9,12,15-17H,2-4,10-11,13-14H2,1H3,(H2,21,22,23);1H |
| InChIKey | CXOFQLWYMIXZQZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|