C19H27N5O3 — CID 111905243
methyl 5-[[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]methyl]-2-methoxybenzoate (PubChem CID 111905243) has the molecular formula C19H27N5O3 and a molecular weight of 373.46 g/mol. Its IUPAC name is methyl 5-[[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]methyl]-2-methoxybenzoate.
| Compound Name | methyl 5-[[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 111905243 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | methyl 5-[[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]methyl]-2-methoxybenzoate |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(C(=O)OC)c1)NCCCn1cccn1 |
| InChI | InChI=1S/C19H27N5O3/c1-4-20-19(21-9-5-11-24-12-6-10-23-24)22-14-15-7-8-17(26-2)16(13-15)18(25)27-3/h6-8,10,12-13H,4-5,9,11,14H2,1-3H3,(H2,20,21,22) |
| InChIKey | FORYUZVLMWAIAS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|