C18H26BrN5O2 — CID 111904817
2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-(3-pyrazol-1-ylpropyl)guanidine (PubChem CID 111904817) has the molecular formula C18H26BrN5O2 and a molecular weight of 424.34 g/mol. Its IUPAC name is 2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-(3-pyrazol-1-ylpropyl)guanidine.
| Compound Name | 2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-(3-pyrazol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111904817 |
| Molecular Formula | C18H26BrN5O2 |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-(3-pyrazol-1-ylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1cc(Br)c(OC)c(OC)c1)NCCCn1cccn1 |
| InChI | InChI=1S/C18H26BrN5O2/c1-4-20-18(21-7-5-9-24-10-6-8-23-24)22-13-14-11-15(19)17(26-3)16(12-14)25-2/h6,8,10-12H,4-5,7,9,13H2,1-3H3,(H2,20,21,22) |
| InChIKey | BBZZEIXLVCRANS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|