C16H22BrN5 — CID 111875711
2-[(4-bromophenyl)methyl]-1-ethyl-3-(3-pyrazol-1-ylpropyl)guanidine (PubChem CID 111875711) has the molecular formula C16H22BrN5 and a molecular weight of 364.29 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-1-ethyl-3-(3-pyrazol-1-ylpropyl)guanidine.
| Compound Name | 2-[(4-bromophenyl)methyl]-1-ethyl-3-(3-pyrazol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111875711 |
| Molecular Formula | C16H22BrN5 |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-1-ethyl-3-(3-pyrazol-1-ylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Br)cc1)NCCCn1cccn1 |
| InChI | InChI=1S/C16H22BrN5/c1-2-18-16(19-9-3-11-22-12-4-10-21-22)20-13-14-5-7-15(17)8-6-14/h4-8,10,12H,2-3,9,11,13H2,1H3,(H2,18,19,20) |
| InChIKey | IBFIYZKBMVEXNJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|