C15H22ClIN6 — CID 111905546
2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111905546) has the molecular formula C15H22ClIN6 and a molecular weight of 448.74 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111905546 |
| Molecular Formula | C15H22ClIN6 |
| Molecular Weight | 448.74 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Cl)nc1)NCCCn1cccn1.I |
| InChI | InChI=1S/C15H21ClN6.HI/c1-2-17-15(18-7-3-9-22-10-4-8-21-22)20-12-13-5-6-14(16)19-11-13;/h4-6,8,10-11H,2-3,7,9,12H2,1H3,(H2,17,18,20);1H |
| InChIKey | OVCDKBTURHMJLD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.74 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|