C16H28ClIN4 — CID 111580072
2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-(5-methylhexyl)guanidine;hydroiodide (PubChem CID 111580072) has the molecular formula C16H28ClIN4 and a molecular weight of 438.79 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-(5-methylhexyl)guanidine;hydroiodide.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-(5-methylhexyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111580072 |
| Molecular Formula | C16H28ClIN4 |
| Molecular Weight | 438.79 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-(5-methylhexyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Cl)nc1)NCCCCC(C)C.I |
| InChI | InChI=1S/C16H27ClN4.HI/c1-4-18-16(19-10-6-5-7-13(2)3)21-12-14-8-9-15(17)20-11-14;/h8-9,11,13H,4-7,10,12H2,1-3H3,(H2,18,19,21);1H |
| InChIKey | NOMDWYJEIJTLIE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.79 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|