C17H20Cl2N4 — CID 111357504
1-[2-(3-chlorophenyl)ethyl]-2-[(6-chloro-3-pyridinyl)methyl]-3-ethylguanidine (PubChem CID 111357504) has the molecular formula C17H20Cl2N4 and a molecular weight of 351.28 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-2-[(6-chloro-3-pyridinyl)methyl]-3-ethylguanidine.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-2-[(6-chloro-3-pyridinyl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111357504 |
| Molecular Formula | C17H20Cl2N4 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-2-[(6-chloro-3-pyridinyl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(Cl)nc1)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H20Cl2N4/c1-2-20-17(23-12-14-6-7-16(19)22-11-14)21-9-8-13-4-3-5-15(18)10-13/h3-7,10-11H,2,8-9,12H2,1H3,(H2,20,21,23) |
| InChIKey | ACAIKBBXOIEVKT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|