C18H23ClN4O — CID 111358042
1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[(2-methoxy-4-pyridinyl)methyl]guanidine (PubChem CID 111358042) has the molecular formula C18H23ClN4O and a molecular weight of 346.86 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[(2-methoxy-4-pyridinyl)methyl]guanidine.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[(2-methoxy-4-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111358042 |
| Molecular Formula | C18H23ClN4O |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[(2-methoxy-4-pyridinyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(OC)c1)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H23ClN4O/c1-3-20-18(22-10-7-14-5-4-6-16(19)11-14)23-13-15-8-9-21-17(12-15)24-2/h4-6,8-9,11-12H,3,7,10,13H2,1-2H3,(H2,20,22,23) |
| InChIKey | SIGPMSRFENUBIB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|