C17H22ClIN4 — CID 110950097
2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-(1-phenylethyl)guanidine;hydroiodide (PubChem CID 110950097) has the molecular formula C17H22ClIN4 and a molecular weight of 444.75 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-(1-phenylethyl)guanidine;hydroiodide.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-(1-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110950097 |
| Molecular Formula | C17H22ClIN4 |
| Molecular Weight | 444.75 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-(1-phenylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Cl)nc1)NC(C)c1ccccc1.I |
| InChI | InChI=1S/C17H21ClN4.HI/c1-3-19-17(21-12-14-9-10-16(18)20-11-14)22-13(2)15-7-5-4-6-8-15;/h4-11,13H,3,12H2,1-2H3,(H2,19,21,22);1H |
| InChIKey | NDGRSHVOHVCAJT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.75 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|